C12H11ClFN3O — CID 87727171
2-[(2-chloropyrimidin-4-yl)amino]-1-(3-fluorophenyl)ethanol (PubChem CID 87727171) has the molecular formula C12H11ClFN3O and a molecular weight of 267.69 g/mol. Its IUPAC name is 2-[(2-chloropyrimidin-4-yl)amino]-1-(3-fluorophenyl)ethanol.
| Compound Name | 2-[(2-chloropyrimidin-4-yl)amino]-1-(3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 87727171 |
| Molecular Formula | C12H11ClFN3O |
| Molecular Weight | 267.69 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-[(2-chloropyrimidin-4-yl)amino]-1-(3-fluorophenyl)ethanol |
| SMILES | OC(CNc1ccnc(Cl)n1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H11ClFN3O/c13-12-15-5-4-11(17-12)16-7-10(18)8-2-1-3-9(14)6-8/h1-6,10,18H,7H2,(H,15,16,17) |
| InChIKey | FBEPQXVGBMAFPL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.69 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |