C12H12ClN3O — CID 87737078
(1S)-2-[(2-chloropyrimidin-4-yl)amino]-1-phenylethanol (PubChem CID 87737078) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is (1S)-2-[(2-chloropyrimidin-4-yl)amino]-1-phenylethanol.
| Compound Name | (1S)-2-[(2-chloropyrimidin-4-yl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 87737078 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (1S)-2-[(2-chloropyrimidin-4-yl)amino]-1-phenylethanol |
| SMILES | O[C@H](CNc1ccnc(Cl)n1)c1ccccc1 |
| InChI | InChI=1S/C12H12ClN3O/c13-12-14-7-6-11(16-12)15-8-10(17)9-4-2-1-3-5-9/h1-7,10,17H,8H2,(H,14,15,16)/t10-/m1/s1 |
| InChIKey | RVBLEKGKZIGVJT-SNVBAGLBSA-N |
| XLogP | 2.28 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |