C13H14ClN3OS — CID 80545491
2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-1-phenylethanol (PubChem CID 80545491) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-1-phenylethanol.
| Compound Name | 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 80545491 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-1-phenylethanol |
| SMILES | CSc1nc(Cl)cc(NCC(O)c2ccccc2)n1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-19-13-16-11(14)7-12(17-13)15-8-10(18)9-5-3-2-4-6-9/h2-7,10,18H,8H2,1H3,(H,15,16,17) |
| InChIKey | ACERTGWRSYAWSN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |