C9H14ClN3O2S — CID 80547085
1-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-3-methoxypropan-2-ol (PubChem CID 80547085) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is 1-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-3-methoxypropan-2-ol.
| Compound Name | 1-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 80547085 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CNc1cc(Cl)nc(SC)n1 |
| InChI | InChI=1S/C9H14ClN3O2S/c1-15-5-6(14)4-11-8-3-7(10)12-9(13-8)16-2/h3,6,14H,4-5H2,1-2H3,(H,11,12,13) |
| InChIKey | SYXFTFGGHNLWLC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |