C9H16N4O2 — CID 78993257
1-[(2-amino-6-methylpyrimidin-4-yl)amino]-3-methoxypropan-2-ol (PubChem CID 78993257) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-[(2-amino-6-methylpyrimidin-4-yl)amino]-3-methoxypropan-2-ol.
| Compound Name | 1-[(2-amino-6-methylpyrimidin-4-yl)amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 78993257 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-[(2-amino-6-methylpyrimidin-4-yl)amino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CNc1cc(C)nc(N)n1 |
| InChI | InChI=1S/C9H16N4O2/c1-6-3-8(13-9(10)12-6)11-4-7(14)5-15-2/h3,7,14H,4-5H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | GUUZTFWQZLELJF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |