C10H15F3N4O2 — CID 102720773
1-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]-3-methoxypropan-2-ol (PubChem CID 102720773) has the molecular formula C10H15F3N4O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 102720773 |
| Molecular Formula | C10H15F3N4O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CNc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C10H15F3N4O2/c1-19-5-7(18)4-15-8-2-6(10(11,12)13)3-9(16-8)17-14/h2-3,7,18H,4-5,14H2,1H3,(H2,15,16,17) |
| InChIKey | DEKNDCDTNBBPMM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|