C9H12F3N5O — CID 102720469
3-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]propanamide (PubChem CID 102720469) has the molecular formula C9H12F3N5O and a molecular weight of 263.22 g/mol. Its IUPAC name is 3-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]propanamide.
| Compound Name | 3-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 102720469 |
| Molecular Formula | C9H12F3N5O |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]propanamide |
| SMILES | NNc1cc(C(F)(F)F)cc(NCCC(N)=O)n1 |
| InChI | InChI=1S/C9H12F3N5O/c10-9(11,12)5-3-7(15-2-1-6(13)18)16-8(4-5)17-14/h3-4H,1-2,14H2,(H2,13,18)(H2,15,16,17) |
| InChIKey | RHRMKPRELBVINT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|