C12H18F3N5O — CID 102719108
2-[[6-(propylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]ethylurea (PubChem CID 102719108) has the molecular formula C12H18F3N5O and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[[6-(propylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]ethylurea.
| Compound Name | 2-[[6-(propylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]ethylurea |
|---|---|
| PubChem CID | 102719108 |
| Molecular Formula | C12H18F3N5O |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-[[6-(propylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]ethylurea |
| SMILES | CCCNc1cc(C(F)(F)F)cc(NCCNC(N)=O)n1 |
| InChI | InChI=1S/C12H18F3N5O/c1-2-3-17-9-6-8(12(13,14)15)7-10(20-9)18-4-5-19-11(16)21/h6-7H,2-5H2,1H3,(H3,16,19,21)(H2,17,18,20) |
| InChIKey | WFFQBOVJXWFRRF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|