C9H13F3N6O — CID 102721067
2-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]ethylurea (PubChem CID 102721067) has the molecular formula C9H13F3N6O and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]ethylurea.
| Compound Name | 2-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]ethylurea |
|---|---|
| PubChem CID | 102721067 |
| Molecular Formula | C9H13F3N6O |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]ethylurea |
| SMILES | NNc1cc(C(F)(F)F)cc(NCCNC(N)=O)n1 |
| InChI | InChI=1S/C9H13F3N6O/c10-9(11,12)5-3-6(17-7(4-5)18-14)15-1-2-16-8(13)19/h3-4H,1-2,14H2,(H3,13,16,19)(H2,15,17,18) |
| InChIKey | HEMVXZRRNTZXPK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|