C7H13N7O — CID 83118066
2-[(6-hydrazinylpyrimidin-4-yl)amino]ethylurea (PubChem CID 83118066) has the molecular formula C7H13N7O and a molecular weight of 211.23 g/mol. Its IUPAC name is 2-[(6-hydrazinylpyrimidin-4-yl)amino]ethylurea.
| Compound Name | 2-[(6-hydrazinylpyrimidin-4-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83118066 |
| Molecular Formula | C7H13N7O |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-[(6-hydrazinylpyrimidin-4-yl)amino]ethylurea |
| SMILES | NNc1cc(NCCNC(N)=O)ncn1 |
| InChI | InChI=1S/C7H13N7O/c8-7(15)11-2-1-10-5-3-6(14-9)13-4-12-5/h3-4H,1-2,9H2,(H3,8,11,15)(H2,10,12,13,14) |
| InChIKey | WIFUTUFCPIVFAV-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|