C9H17N7O — CID 83117256
2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]ethylurea (PubChem CID 83117256) has the molecular formula C9H17N7O and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]ethylurea.
| Compound Name | 2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83117256 |
| Molecular Formula | C9H17N7O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]ethylurea |
| SMILES | CCc1nc(NN)cc(NCCNC(N)=O)n1 |
| InChI | InChI=1S/C9H17N7O/c1-2-6-14-7(5-8(15-6)16-11)12-3-4-13-9(10)17/h5H,2-4,11H2,1H3,(H3,10,13,17)(H2,12,14,15,16) |
| InChIKey | KNSGASLNCFHTAP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|