C10H18N6O2 — CID 106242008
2-[2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]ethoxy]acetamide (PubChem CID 106242008) has the molecular formula C10H18N6O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106242008 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-[2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]ethoxy]acetamide |
| SMILES | CCc1nc(NN)cc(NCCOCC(N)=O)n1 |
| InChI | InChI=1S/C10H18N6O2/c1-2-8-14-9(5-10(15-8)16-12)13-3-4-18-6-7(11)17/h5H,2-4,6,12H2,1H3,(H2,11,17)(H2,13,14,15,16) |
| InChIKey | WQHSCTISSKUEGJ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|