C11H20N6O — CID 83117490
2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]ethylurea (PubChem CID 83117490) has the molecular formula C11H20N6O and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]ethylurea.
| Compound Name | 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]ethylurea |
|---|---|
| PubChem CID | 83117490 |
| Molecular Formula | C11H20N6O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]ethylurea |
| SMILES | CCCNc1cc(NCCNC(N)=O)nc(C)n1 |
| InChI | InChI=1S/C11H20N6O/c1-3-4-13-9-7-10(17-8(2)16-9)14-5-6-15-11(12)18/h7H,3-6H2,1-2H3,(H3,12,15,18)(H2,13,14,16,17) |
| InChIKey | PMZONIORJILMTC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|