C9H14N4S — CID 130631586
2-methyl-6-(propylamino)pyrimidine-4-carbothioamide (PubChem CID 130631586) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 2-methyl-6-(propylamino)pyrimidine-4-carbothioamide.
| Compound Name | 2-methyl-6-(propylamino)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 130631586 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-methyl-6-(propylamino)pyrimidine-4-carbothioamide |
| SMILES | CCCNc1cc(C(N)=S)nc(C)n1 |
| InChI | InChI=1S/C9H14N4S/c1-3-4-11-8-5-7(9(10)14)12-6(2)13-8/h5H,3-4H2,1-2H3,(H2,10,14)(H,11,12,13) |
| InChIKey | XRRZDVASIBKCQH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|