C10H19N5O2S — CID 80787489
2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]ethanesulfonamide (PubChem CID 80787489) has the molecular formula C10H19N5O2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]ethanesulfonamide.
| Compound Name | 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 80787489 |
| Molecular Formula | C10H19N5O2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]ethanesulfonamide |
| SMILES | CCCNc1cc(NCCS(N)(=O)=O)nc(C)n1 |
| InChI | InChI=1S/C10H19N5O2S/c1-3-4-12-9-7-10(15-8(2)14-9)13-5-6-18(11,16)17/h7H,3-6H2,1-2H3,(H2,11,16,17)(H2,12,13,14,15) |
| InChIKey | XUEUYQZNFNGOKX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |