C8H14N4O2S — CID 80791666
2-methyl-4-N-(2-methylsulfonylethyl)pyrimidine-4,6-diamine (PubChem CID 80791666) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-methyl-4-N-(2-methylsulfonylethyl)pyrimidine-4,6-diamine.
| Compound Name | 2-methyl-4-N-(2-methylsulfonylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80791666 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-methyl-4-N-(2-methylsulfonylethyl)pyrimidine-4,6-diamine |
| SMILES | Cc1nc(N)cc(NCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C8H14N4O2S/c1-6-11-7(9)5-8(12-6)10-3-4-15(2,13)14/h5H,3-4H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | XRVWRPJCQQDLRM-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |