C10H18N4O2S — CID 80934736
2-ethyl-4-N-(3-methylsulfonylpropyl)pyrimidine-4,6-diamine (PubChem CID 80934736) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 2-ethyl-4-N-(3-methylsulfonylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 2-ethyl-4-N-(3-methylsulfonylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80934736 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-ethyl-4-N-(3-methylsulfonylpropyl)pyrimidine-4,6-diamine |
| SMILES | CCc1nc(N)cc(NCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H18N4O2S/c1-3-9-13-8(11)7-10(14-9)12-5-4-6-17(2,15)16/h7H,3-6H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | DXWVCJXHGFPANP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|