C9H14ClN3O2S — CID 102809402
6-chloro-2-N-(3-methylsulfonylpropyl)pyridine-2,4-diamine (PubChem CID 102809402) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is 6-chloro-2-N-(3-methylsulfonylpropyl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(3-methylsulfonylpropyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 102809402 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 6-chloro-2-N-(3-methylsulfonylpropyl)pyridine-2,4-diamine |
| SMILES | CS(=O)(=O)CCCNc1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C9H14ClN3O2S/c1-16(14,15)4-2-3-12-9-6-7(11)5-8(10)13-9/h5-6H,2-4H2,1H3,(H3,11,12,13) |
| InChIKey | DLVVAEICDDDJKD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|