C10H16N2O3S — CID 63591649
6-methoxy-N-(3-methylsulfonylpropyl)pyridin-2-amine (PubChem CID 63591649) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 6-methoxy-N-(3-methylsulfonylpropyl)pyridin-2-amine.
| Compound Name | 6-methoxy-N-(3-methylsulfonylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63591649 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 6-methoxy-N-(3-methylsulfonylpropyl)pyridin-2-amine |
| SMILES | COc1cccc(NCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H16N2O3S/c1-15-10-6-3-5-9(12-10)11-7-4-8-16(2,13)14/h3,5-6H,4,7-8H2,1-2H3,(H,11,12) |
| InChIKey | OGLJRCGVMIVJIP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|