C10H16N2OS — CID 63965720
6-methoxy-N-(3-methylsulfanylpropyl)pyridin-2-amine (PubChem CID 63965720) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 6-methoxy-N-(3-methylsulfanylpropyl)pyridin-2-amine.
| Compound Name | 6-methoxy-N-(3-methylsulfanylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63965720 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 6-methoxy-N-(3-methylsulfanylpropyl)pyridin-2-amine |
| SMILES | COc1cccc(NCCCSC)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-13-10-6-3-5-9(12-10)11-7-4-8-14-2/h3,5-6H,4,7-8H2,1-2H3,(H,11,12) |
| InChIKey | GIVQRNPFCLHSRK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|