C10H13F3N2O2 — CID 55259536
6-methoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine (PubChem CID 55259536) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 6-methoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine.
| Compound Name | 6-methoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 55259536 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 6-methoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine |
| SMILES | COc1cccc(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O2/c1-16-9-4-2-3-8(15-9)14-5-6-17-7-10(11,12)13/h2-4H,5-7H2,1H3,(H,14,15) |
| InChIKey | NOJLFFZCNMYDMT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|