C16H20Cl2N4O2 — CID 101398050
6-chloro-N-[2-[2-[2-[(6-chloro-2-pyridinyl)amino]ethoxy]ethoxy]ethyl]pyridin-2-amine (PubChem CID 101398050) has the molecular formula C16H20Cl2N4O2 and a molecular weight of 371.27 g/mol. Its IUPAC name is 6-chloro-N-[2-[2-[2-[(6-chloro-2-pyridinyl)amino]ethoxy]ethoxy]ethyl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[2-[2-[2-[(6-chloro-2-pyridinyl)amino]ethoxy]ethoxy]ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 101398050 |
| Molecular Formula | C16H20Cl2N4O2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 6-chloro-N-[2-[2-[2-[(6-chloro-2-pyridinyl)amino]ethoxy]ethoxy]ethyl]pyridin-2-amine |
| SMILES | Clc1cccc(NCCOCCOCCNc2cccc(Cl)n2)n1 |
| InChI | InChI=1S/C16H20Cl2N4O2/c17-13-3-1-5-15(21-13)19-7-9-23-11-12-24-10-8-20-16-6-2-4-14(18)22-16/h1-6H,7-12H2,(H,19,21)(H,20,22) |
| InChIKey | WVWBRPTZQCXGBR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|