About N'-(6-chloro-2-pyridinyl)butane-1,4-diamine
N'-(6-chloro-2-pyridinyl)butane-1,4-diamine (PubChem CID 117097392) has the molecular formula C9H14ClN3
and a molecular weight of 199.69 g/mol. Its IUPAC name is N'-(6-chloro-2-pyridinyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-(6-chloro-2-pyridinyl)butane-1,4-diamine |
| PubChem CID | 117097392 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | N'-(6-chloro-2-pyridinyl)butane-1,4-diamine |
| SMILES | NCCCCNc1cccc(Cl)n1 |
| InChI | InChI=1S/C9H14ClN3/c10-8-4-3-5-9(13-8)12-7-2-1-6-11/h3-5H,1-2,6-7,11H2,(H,12,13) |
| InChIKey | XJQPKFNHMLVQOX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-chloro-2-pyridinyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-chloro-2-pyridinyl)butane-1,4-diamine?
The IUPAC name of N'-(6-chloro-2-pyridinyl)butane-1,4-diamine (CID 117097392) is N'-(6-chloro-2-pyridinyl)butane-1,4-diamine.
What is the SMILES notation for N'-(6-chloro-2-pyridinyl)butane-1,4-diamine?
The canonical SMILES for N'-(6-chloro-2-pyridinyl)butane-1,4-diamine is NCCCCNc1cccc(Cl)n1.
What is the InChIKey of N'-(6-chloro-2-pyridinyl)butane-1,4-diamine?
The InChIKey is XJQPKFNHMLVQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3/c10-8-4-3-5-9(13-8)12-7-2-1-6-11/h3-5H,1-2,6-7,11H2,(H,12,13).
What are the key properties of N'-(6-chloro-2-pyridinyl)butane-1,4-diamine?
N'-(6-chloro-2-pyridinyl)butane-1,4-diamine has a molecular weight of 199.69 g/mol, XLogP of 1.89, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-chloro-2-pyridinyl)butane-1,4-diamine is sourced from PubChem (CID 117097392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).