C7H11ClN4O2S — CID 84761064
N'-[(6-chloro-2-pyridinyl)sulfamoyl]ethane-1,2-diamine (PubChem CID 84761064) has the molecular formula C7H11ClN4O2S and a molecular weight of 250.71 g/mol. Its IUPAC name is N'-[(6-chloro-2-pyridinyl)sulfamoyl]ethane-1,2-diamine.
| Compound Name | N'-[(6-chloro-2-pyridinyl)sulfamoyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 84761064 |
| Molecular Formula | C7H11ClN4O2S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | N'-[(6-chloro-2-pyridinyl)sulfamoyl]ethane-1,2-diamine |
| SMILES | NCCNS(=O)(=O)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C7H11ClN4O2S/c8-6-2-1-3-7(11-6)12-15(13,14)10-5-4-9/h1-3,10H,4-5,9H2,(H,11,12) |
| InChIKey | OVFFLESPYAXXCC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|