C11H11ClN2O2S2 — CID 104821321
N-(6-chloro-2-pyridinyl)-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 104821321) has the molecular formula C11H11ClN2O2S2 and a molecular weight of 302.81 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-2,5-dimethylthiophene-3-sulfonamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-2,5-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 104821321 |
| Molecular Formula | C11H11ClN2O2S2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cccc(Cl)n2)c(C)s1 |
| InChI | InChI=1S/C11H11ClN2O2S2/c1-7-6-9(8(2)17-7)18(15,16)14-11-5-3-4-10(12)13-11/h3-6H,1-2H3,(H,13,14) |
| InChIKey | BTVVPOSEFUEFGG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|