C13H13N3O2S2 — CID 63563330
N-(1H-benzimidazol-2-yl)-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 63563330) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-2,5-dimethylthiophene-3-sulfonamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-2,5-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 63563330 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2nc3ccccc3[nH]2)c(C)s1 |
| InChI | InChI=1S/C13H13N3O2S2/c1-8-7-12(9(2)19-8)20(17,18)16-13-14-10-5-3-4-6-11(10)15-13/h3-7H,1-2H3,(H2,14,15,16) |
| InChIKey | LFVFDIVZBCDYKH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |