C17H19ClN4O4S2 — CID 75433916
3-N-(1H-benzimidazol-2-yl)-4-chloro-1-N,1-N-diethylbenzene-1,3-disulfonamide (PubChem CID 75433916) has the molecular formula C17H19ClN4O4S2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 3-N-(1H-benzimidazol-2-yl)-4-chloro-1-N,1-N-diethylbenzene-1,3-disulfonamide.
| Compound Name | 3-N-(1H-benzimidazol-2-yl)-4-chloro-1-N,1-N-diethylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 75433916 |
| Molecular Formula | C17H19ClN4O4S2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 3-N-(1H-benzimidazol-2-yl)-4-chloro-1-N,1-N-diethylbenzene-1,3-disulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(S(=O)(=O)Nc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C17H19ClN4O4S2/c1-3-22(4-2)28(25,26)12-9-10-13(18)16(11-12)27(23,24)21-17-19-14-7-5-6-8-15(14)20-17/h5-11H,3-4H2,1-2H3,(H2,19,20,21) |
| InChIKey | LQJSYBYREJVVJX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |