C11H16ClNO4S2 — CID 35290992
2-chloro-N,N-diethyl-5-methylsulfonylbenzenesulfonamide (PubChem CID 35290992) has the molecular formula C11H16ClNO4S2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-chloro-N,N-diethyl-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 35290992 |
| Molecular Formula | C11H16ClNO4S2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2-chloro-N,N-diethyl-5-methylsulfonylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C11H16ClNO4S2/c1-4-13(5-2)19(16,17)11-8-9(18(3,14)15)6-7-10(11)12/h6-8H,4-5H2,1-3H3 |
| InChIKey | VFMYAOJQSOSQHD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |