C10H13ClFNO2S — CID 115610807
2-chloro-N,N-diethyl-5-fluorobenzenesulfonamide (PubChem CID 115610807) has the molecular formula C10H13ClFNO2S and a molecular weight of 265.74 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-5-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N,N-diethyl-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115610807 |
| Molecular Formula | C10H13ClFNO2S |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2-chloro-N,N-diethyl-5-fluorobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C10H13ClFNO2S/c1-3-13(4-2)16(14,15)10-7-8(12)5-6-9(10)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | PBFVIQMFUOBCEO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |