C10H12Cl2FNO2S — CID 103087908
2,4-dichloro-N,N-diethyl-3-fluorobenzenesulfonamide (PubChem CID 103087908) has the molecular formula C10H12Cl2FNO2S and a molecular weight of 300.18 g/mol. Its IUPAC name is 2,4-dichloro-N,N-diethyl-3-fluorobenzenesulfonamide.
| Compound Name | 2,4-dichloro-N,N-diethyl-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103087908 |
| Molecular Formula | C10H12Cl2FNO2S |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 2,4-dichloro-N,N-diethyl-3-fluorobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C10H12Cl2FNO2S/c1-3-14(4-2)17(15,16)8-6-5-7(11)10(13)9(8)12/h5-6H,3-4H2,1-2H3 |
| InChIKey | RMPQBOZEWSKHAG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|