C11H12Cl2FNO3S — CID 91662378
2,4-dichloro-N-cyclopropyl-3-fluoro-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 91662378) has the molecular formula C11H12Cl2FNO3S and a molecular weight of 328.19 g/mol. Its IUPAC name is 2,4-dichloro-N-cyclopropyl-3-fluoro-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-cyclopropyl-3-fluoro-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91662378 |
| Molecular Formula | C11H12Cl2FNO3S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2,4-dichloro-N-cyclopropyl-3-fluoro-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)c(F)c1Cl)N(CCO)C1CC1 |
| InChI | InChI=1S/C11H12Cl2FNO3S/c12-8-3-4-9(10(13)11(8)14)19(17,18)15(5-6-16)7-1-2-7/h3-4,7,16H,1-2,5-6H2 |
| InChIKey | ARECWRYXCANPFB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|