C13H17Cl2FN2O2S — CID 103089103
N-(4-aminocyclohexyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide (PubChem CID 103089103) has the molecular formula C13H17Cl2FN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(4-aminocyclohexyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103089103 |
| Molecular Formula | C13H17Cl2FN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-(4-aminocyclohexyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCC(N)CC1)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C13H17Cl2FN2O2S/c1-18(9-4-2-8(17)3-5-9)21(19,20)11-7-6-10(14)13(16)12(11)15/h6-9H,2-5,17H2,1H3 |
| InChIKey | XNDRSNWCRCYQLM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|