C11H12Cl2FNO3S — CID 99858909
2,4-dichloro-3-fluoro-N-methyl-N-[(3R)-oxolan-3-yl]benzenesulfonamide (PubChem CID 99858909) has the molecular formula C11H12Cl2FNO3S and a molecular weight of 328.19 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-methyl-N-[(3R)-oxolan-3-yl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-methyl-N-[(3R)-oxolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 99858909 |
| Molecular Formula | C11H12Cl2FNO3S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-methyl-N-[(3R)-oxolan-3-yl]benzenesulfonamide |
| SMILES | CN([C@@H]1CCOC1)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H12Cl2FNO3S/c1-15(7-4-5-18-6-7)19(16,17)9-3-2-8(12)11(14)10(9)13/h2-3,7H,4-6H2,1H3/t7-/m1/s1 |
| InChIKey | BAVSVXSDSRWJES-SSDOTTSWSA-N |
| XLogP | 2.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|