C12H15ClN2O5S — CID 81495206
4-chloro-N,2-dimethyl-5-nitro-N-(oxolan-3-yl)benzenesulfonamide (PubChem CID 81495206) has the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. Its IUPAC name is 4-chloro-N,2-dimethyl-5-nitro-N-(oxolan-3-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N,2-dimethyl-5-nitro-N-(oxolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 81495206 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-chloro-N,2-dimethyl-5-nitro-N-(oxolan-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(Cl)c([N+](=O)[O-])cc1S(=O)(=O)N(C)C1CCOC1 |
| InChI | InChI=1S/C12H15ClN2O5S/c1-8-5-10(13)11(15(16)17)6-12(8)21(18,19)14(2)9-3-4-20-7-9/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | SDMWHLIBDGWXNP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|