C8H8Cl2FNO3S — CID 103087901
2,4-dichloro-3-fluoro-N-methoxy-N-methylbenzenesulfonamide (PubChem CID 103087901) has the molecular formula C8H8Cl2FNO3S and a molecular weight of 288.13 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103087901 |
| Molecular Formula | C8H8Cl2FNO3S |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-methoxy-N-methylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C8H8Cl2FNO3S/c1-12(15-2)16(13,14)6-4-3-5(9)8(11)7(6)10/h3-4H,1-2H3 |
| InChIKey | RCJNJPWHDOQRBW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|