C10H11BrCl2FNO2S — CID 103089670
N-(2-bromopropyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide (PubChem CID 103089670) has the molecular formula C10H11BrCl2FNO2S and a molecular weight of 379.08 g/mol. Its IUPAC name is N-(2-bromopropyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(2-bromopropyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103089670 |
| Molecular Formula | C10H11BrCl2FNO2S |
| Molecular Weight | 379.08 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | N-(2-bromopropyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide |
| SMILES | CC(Br)CN(C)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C10H11BrCl2FNO2S/c1-6(11)5-15(2)18(16,17)8-4-3-7(12)10(14)9(8)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | CISJMPLDRJDFIV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.08 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|