C11H13BrCl2FNO2S — CID 103089842
N-(2-bromopentyl)-2,4-dichloro-3-fluorobenzenesulfonamide (PubChem CID 103089842) has the molecular formula C11H13BrCl2FNO2S and a molecular weight of 393.11 g/mol. Its IUPAC name is N-(2-bromopentyl)-2,4-dichloro-3-fluorobenzenesulfonamide.
| Compound Name | N-(2-bromopentyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103089842 |
| Molecular Formula | C11H13BrCl2FNO2S |
| Molecular Weight | 393.11 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | N-(2-bromopentyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
| SMILES | CCCC(Br)CNS(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H13BrCl2FNO2S/c1-2-3-7(12)6-16-19(17,18)9-5-4-8(13)11(15)10(9)14/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | XTGUMYDIMUMYRX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.11 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|