C13H9BrCl2FNO2S — CID 103088278
N-[(2-bromophenyl)methyl]-2,4-dichloro-3-fluorobenzenesulfonamide (PubChem CID 103088278) has the molecular formula C13H9BrCl2FNO2S and a molecular weight of 413.10 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2,4-dichloro-3-fluorobenzenesulfonamide.
| Compound Name | N-[(2-bromophenyl)methyl]-2,4-dichloro-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103088278 |
| Molecular Formula | C13H9BrCl2FNO2S |
| Molecular Weight | 413.10 g/mol |
| Exact Mass | 410.89 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2,4-dichloro-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1Br)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C13H9BrCl2FNO2S/c14-9-4-2-1-3-8(9)7-18-21(19,20)11-6-5-10(15)13(17)12(11)16/h1-6,18H,7H2 |
| InChIKey | WLVQQTQJTSWSRT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.10 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|