C11H7BrCl2FNO2S2 — CID 103088311
N-[(3-bromothiophen-2-yl)methyl]-2,4-dichloro-3-fluorobenzenesulfonamide (PubChem CID 103088311) has the molecular formula C11H7BrCl2FNO2S2 and a molecular weight of 419.12 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-2,4-dichloro-3-fluorobenzenesulfonamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-2,4-dichloro-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103088311 |
| Molecular Formula | C11H7BrCl2FNO2S2 |
| Molecular Weight | 419.12 g/mol |
| Exact Mass | 416.85 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-2,4-dichloro-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1sccc1Br)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H7BrCl2FNO2S2/c12-6-3-4-19-8(6)5-16-20(17,18)9-2-1-7(13)11(15)10(9)14/h1-4,16H,5H2 |
| InChIKey | YHHROYGTNIRRAO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.12 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|