C12H6BrCl2F2NO2S — CID 107640855
N-(2-bromo-5-fluorophenyl)-2,4-dichloro-3-fluorobenzenesulfonamide (PubChem CID 107640855) has the molecular formula C12H6BrCl2F2NO2S and a molecular weight of 417.06 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-2,4-dichloro-3-fluorobenzenesulfonamide.
| Compound Name | N-(2-bromo-5-fluorophenyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107640855 |
| Molecular Formula | C12H6BrCl2F2NO2S |
| Molecular Weight | 417.06 g/mol |
| Exact Mass | 414.86 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)ccc1Br)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C12H6BrCl2F2NO2S/c13-7-2-1-6(16)5-9(7)18-21(19,20)10-4-3-8(14)12(17)11(10)15/h1-5,18H |
| InChIKey | DRZLCZYLXWRGRZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.06 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|