C13H10Cl2FNO3S — CID 103088377
2,4-dichloro-3-fluoro-N-(2-hydroxy-4-methylphenyl)benzenesulfonamide (PubChem CID 103088377) has the molecular formula C13H10Cl2FNO3S and a molecular weight of 350.20 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-(2-hydroxy-4-methylphenyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-(2-hydroxy-4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103088377 |
| Molecular Formula | C13H10Cl2FNO3S |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-(2-hydroxy-4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Cl)c(F)c2Cl)c(O)c1 |
| InChI | InChI=1S/C13H10Cl2FNO3S/c1-7-2-4-9(10(18)6-7)17-21(19,20)11-5-3-8(14)13(16)12(11)15/h2-6,17-18H,1H3 |
| InChIKey | WHJNNYQFOBRCNF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|