C12H6BrCl3FNO2S — CID 103088310
N-(3-bromo-4-chlorophenyl)-2,4-dichloro-3-fluorobenzenesulfonamide (PubChem CID 103088310) has the molecular formula C12H6BrCl3FNO2S and a molecular weight of 433.51 g/mol. Its IUPAC name is N-(3-bromo-4-chlorophenyl)-2,4-dichloro-3-fluorobenzenesulfonamide.
| Compound Name | N-(3-bromo-4-chlorophenyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103088310 |
| Molecular Formula | C12H6BrCl3FNO2S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 430.84 |
| IUPAC Name | N-(3-bromo-4-chlorophenyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)c(Br)c1)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C12H6BrCl3FNO2S/c13-7-5-6(1-2-8(7)14)18-21(19,20)10-4-3-9(15)12(17)11(10)16/h1-5,18H |
| InChIKey | AJHOBLAQTRGYLS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|