C11H6BrCl2FN2O2S — CID 103223782
N-(6-bromo-3-pyridinyl)-2,4-dichloro-3-fluorobenzenesulfonamide (PubChem CID 103223782) has the molecular formula C11H6BrCl2FN2O2S and a molecular weight of 400.06 g/mol. Its IUPAC name is N-(6-bromo-3-pyridinyl)-2,4-dichloro-3-fluorobenzenesulfonamide.
| Compound Name | N-(6-bromo-3-pyridinyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103223782 |
| Molecular Formula | C11H6BrCl2FN2O2S |
| Molecular Weight | 400.06 g/mol |
| Exact Mass | 397.87 |
| IUPAC Name | N-(6-bromo-3-pyridinyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)nc1)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H6BrCl2FN2O2S/c12-9-4-1-6(5-16-9)17-20(18,19)8-3-2-7(13)11(15)10(8)14/h1-5,17H |
| InChIKey | ARZOQERYQZCLQC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.06 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|