C13H17BrCl2FNO2S — CID 107158110
N-(2-bromo-4,4-dimethylpentyl)-2,4-dichloro-3-fluorobenzenesulfonamide (PubChem CID 107158110) has the molecular formula C13H17BrCl2FNO2S and a molecular weight of 421.16 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-2,4-dichloro-3-fluorobenzenesulfonamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107158110 |
| Molecular Formula | C13H17BrCl2FNO2S |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 418.95 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-2,4-dichloro-3-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)CC(Br)CNS(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C13H17BrCl2FNO2S/c1-13(2,3)6-8(14)7-18-21(19,20)10-5-4-9(15)12(17)11(10)16/h4-5,8,18H,6-7H2,1-3H3 |
| InChIKey | PZWVPUIMSNUXLQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|