C10H10Cl2FNO5S — CID 103215117
(2S)-4-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 103215117) has the molecular formula C10H10Cl2FNO5S and a molecular weight of 346.16 g/mol. Its IUPAC name is (2S)-4-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 103215117 |
| Molecular Formula | C10H10Cl2FNO5S |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | (2S)-4-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-2-hydroxybutanoic acid |
| SMILES | O=C(O)[C@@H](O)CCNS(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C10H10Cl2FNO5S/c11-5-1-2-7(8(12)9(5)13)20(18,19)14-4-3-6(15)10(16)17/h1-2,6,14-15H,3-4H2,(H,16,17)/t6-/m0/s1 |
| InChIKey | UQLAFPCWGSDEMD-LURJTMIESA-N |
| XLogP | 1.25 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|