C9H11FN2O5S — CID 114006728
4-[(3-fluoro-2-pyridinyl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 114006728) has the molecular formula C9H11FN2O5S and a molecular weight of 278.26 g/mol. Its IUPAC name is 4-[(3-fluoro-2-pyridinyl)sulfonylamino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(3-fluoro-2-pyridinyl)sulfonylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114006728 |
| Molecular Formula | C9H11FN2O5S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[(3-fluoro-2-pyridinyl)sulfonylamino]-2-hydroxybutanoic acid |
| SMILES | O=C(O)C(O)CCNS(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C9H11FN2O5S/c10-6-2-1-4-11-8(6)18(16,17)12-5-3-7(13)9(14)15/h1-2,4,7,12-13H,3,5H2,(H,14,15) |
| InChIKey | AWMPKIMLEKJOIC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |