C11H15FN2O5S — CID 103298878
2-[(3-fluoro-2-pyridinyl)sulfonylamino]-5-methoxypentanoic acid (PubChem CID 103298878) has the molecular formula C11H15FN2O5S and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-[(3-fluoro-2-pyridinyl)sulfonylamino]-5-methoxypentanoic acid.
| Compound Name | 2-[(3-fluoro-2-pyridinyl)sulfonylamino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 103298878 |
| Molecular Formula | C11H15FN2O5S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[(3-fluoro-2-pyridinyl)sulfonylamino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NS(=O)(=O)c1ncccc1F)C(=O)O |
| InChI | InChI=1S/C11H15FN2O5S/c1-19-7-3-5-9(11(15)16)14-20(17,18)10-8(12)4-2-6-13-10/h2,4,6,9,14H,3,5,7H2,1H3,(H,15,16) |
| InChIKey | RMBJDTFYCVHPNR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|