C12H17FN2O4S — CID 103298907
3-[(3-fluoro-2-pyridinyl)sulfonylamino]-4,4-dimethylpentanoic acid (PubChem CID 103298907) has the molecular formula C12H17FN2O4S and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-[(3-fluoro-2-pyridinyl)sulfonylamino]-4,4-dimethylpentanoic acid.
| Compound Name | 3-[(3-fluoro-2-pyridinyl)sulfonylamino]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 103298907 |
| Molecular Formula | C12H17FN2O4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-[(3-fluoro-2-pyridinyl)sulfonylamino]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)C(CC(=O)O)NS(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C12H17FN2O4S/c1-12(2,3)9(7-10(16)17)15-20(18,19)11-8(13)5-4-6-14-11/h4-6,9,15H,7H2,1-3H3,(H,16,17) |
| InChIKey | YQFDGLMJVYHELL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |