C12H15N3O5S — CID 106593407
2-[(2-cyano-3-pyridinyl)sulfonylamino]-5-methoxypentanoic acid (PubChem CID 106593407) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[(2-cyano-3-pyridinyl)sulfonylamino]-5-methoxypentanoic acid.
| Compound Name | 2-[(2-cyano-3-pyridinyl)sulfonylamino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 106593407 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[(2-cyano-3-pyridinyl)sulfonylamino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NS(=O)(=O)c1cccnc1C#N)C(=O)O |
| InChI | InChI=1S/C12H15N3O5S/c1-20-7-3-4-9(12(16)17)15-21(18,19)11-5-2-6-14-10(11)8-13/h2,5-6,9,15H,3-4,7H2,1H3,(H,16,17) |
| InChIKey | SYAMQCXXTJTBDA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|