C13H17N3O4S — CID 106546546
tert-butyl (2R)-2-[(2-cyano-3-pyridinyl)sulfonylamino]propanoate (PubChem CID 106546546) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-cyano-3-pyridinyl)sulfonylamino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(2-cyano-3-pyridinyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 106546546 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | tert-butyl (2R)-2-[(2-cyano-3-pyridinyl)sulfonylamino]propanoate |
| SMILES | C[C@@H](NS(=O)(=O)c1cccnc1C#N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H17N3O4S/c1-9(12(17)20-13(2,3)4)16-21(18,19)11-6-5-7-15-10(11)8-14/h5-7,9,16H,1-4H3/t9-/m1/s1 |
| InChIKey | UDRXNYMCQLJKJI-SECBINFHSA-N |
| XLogP | 0.96 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |